C25H32N6OS — CID 99936924
1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]carbamothioyl]-N-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]piperidine-4-carboxamide (PubChem CID 99936924) has the molecular formula C25H32N6OS and a molecular weight of 464.64 g/mol. Its IUPAC name is 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]carbamothioyl]-N-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]carbamothioyl]-N-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 99936924 |
| Molecular Formula | C25H32N6OS |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]carbamothioyl]-N-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]piperidine-4-carboxamide |
| SMILES | CN(CCC#N)c1ccc(/C=N\NC(=O)C2CCN(C(=S)N[C@@H]3C[C@@H]4C=C[C@@H]3C4)CC2)cc1 |
| InChI | InChI=1S/C25H32N6OS/c1-30(12-2-11-26)22-7-4-18(5-8-22)17-27-29-24(32)20-9-13-31(14-10-20)25(33)28-23-16-19-3-6-21(23)15-19/h3-8,17,19-21,23H,2,9-10,12-16H2,1H3,(H,28,33)(H,29,32)/b27-17-/t19-,21-,23-/m1/s1 |
| InChIKey | SGAKTRASLUKNIG-MNGSNFCBSA-N |
| XLogP | 3.04 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|