C14H22N4OS — CID 3554078
N-(2-bicyclo[2.2.1]hept-5-enyl)-4-(hydrazinecarbonyl)piperidine-1-carbothioamide (PubChem CID 3554078) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enyl)-4-(hydrazinecarbonyl)piperidine-1-carbothioamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-4-(hydrazinecarbonyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3554078 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-4-(hydrazinecarbonyl)piperidine-1-carbothioamide |
| SMILES | NNC(=O)C1CCN(C(=S)NC2CC3C=CC2C3)CC1 |
| InChI | InChI=1S/C14H22N4OS/c15-17-13(19)10-3-5-18(6-4-10)14(20)16-12-8-9-1-2-11(12)7-9/h1-2,9-12H,3-8,15H2,(H,16,20)(H,17,19) |
| InChIKey | RHPDTMPEEMZLQX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|