C23H16Cl4N4O4 — CID 126176882
N'-[(Z)-[2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2,3-dichlorophenyl)oxamide (PubChem CID 126176882) has the molecular formula C23H16Cl4N4O4 and a molecular weight of 554.22 g/mol. Its IUPAC name is N'-[(Z)-[2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2,3-dichlorophenyl)oxamide.
| Compound Name | N'-[(Z)-[2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2,3-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 126176882 |
| Molecular Formula | C23H16Cl4N4O4 |
| Molecular Weight | 554.22 g/mol |
| Exact Mass | 551.99 |
| IUPAC Name | N'-[(Z)-[2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2,3-dichlorophenyl)oxamide |
| SMILES | O=C(COc1ccccc1/C=N\NC(=O)C(=O)Nc1cccc(Cl)c1Cl)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H16Cl4N4O4/c24-14-8-15(25)10-16(9-14)29-20(32)12-35-19-7-2-1-4-13(19)11-28-31-23(34)22(33)30-18-6-3-5-17(26)21(18)27/h1-11H,12H2,(H,29,32)(H,30,33)(H,31,34)/b28-11- |
| InChIKey | WNRKYSIIKJLOML-FXMZOFOKSA-N |
| XLogP | 5.41 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.22 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|