C23H18ClFN4O4 — CID 126265929
N'-[(Z)-[2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide (PubChem CID 126265929) has the molecular formula C23H18ClFN4O4 and a molecular weight of 468.87 g/mol. Its IUPAC name is N'-[(Z)-[2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide.
| Compound Name | N'-[(Z)-[2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 126265929 |
| Molecular Formula | C23H18ClFN4O4 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N'-[(Z)-[2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide |
| SMILES | O=C(COc1ccccc1/C=N\NC(=O)C(=O)Nc1ccc(F)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H18ClFN4O4/c24-18-6-2-3-7-19(18)28-21(30)14-33-20-8-4-1-5-15(20)13-26-29-23(32)22(31)27-17-11-9-16(25)10-12-17/h1-13H,14H2,(H,27,31)(H,28,30)(H,29,32)/b26-13- |
| InChIKey | DWNGLANBIOPUAT-ZMFRSBBQSA-N |
| XLogP | 3.59 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|