C25H22BrClN4O4 — CID 126177218
N'-[(Z)-[5-bromo-2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-methylphenyl)methyl]oxamide (PubChem CID 126177218) has the molecular formula C25H22BrClN4O4 and a molecular weight of 557.83 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-methylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126177218 |
| Molecular Formula | C25H22BrClN4O4 |
| Molecular Weight | 557.83 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-methylphenyl)methyl]oxamide |
| SMILES | Cc1ccc(CNC(=O)C(=O)N/N=C\c2cc(Br)ccc2OCC(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H22BrClN4O4/c1-16-6-8-17(9-7-16)13-28-24(33)25(34)31-29-14-18-12-19(26)10-11-22(18)35-15-23(32)30-21-5-3-2-4-20(21)27/h2-12,14H,13,15H2,1H3,(H,28,33)(H,30,32)(H,31,34)/b29-14- |
| InChIKey | XHKMFJXLOPTMCY-NUJZUDFISA-N |
| XLogP | 4.19 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|