C15H11Cl2F2N3S — CID 168612088
benzyl N'-[(2,3-dichloro-5,6-difluorophenyl)methylideneamino]carbamimidothioate (PubChem CID 168612088) has the molecular formula C15H11Cl2F2N3S and a molecular weight of 374.24 g/mol. Its IUPAC name is benzyl N'-[(2,3-dichloro-5,6-difluorophenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(2,3-dichloro-5,6-difluorophenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612088 |
| Molecular Formula | C15H11Cl2F2N3S |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | benzyl N'-[(2,3-dichloro-5,6-difluorophenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1c(F)c(F)cc(Cl)c1Cl)SCc1ccccc1 |
| InChI | InChI=1S/C15H11Cl2F2N3S/c16-11-6-12(18)14(19)10(13(11)17)7-21-22-15(20)23-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,20,22) |
| InChIKey | ZXUIYABBIGNMCI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|