C16H12F5N3OS — CID 168613363
benzyl N'-[[2,3-difluoro-6-(trifluoromethoxy)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613363) has the molecular formula C16H12F5N3OS and a molecular weight of 389.35 g/mol. Its IUPAC name is benzyl N'-[[2,3-difluoro-6-(trifluoromethoxy)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[2,3-difluoro-6-(trifluoromethoxy)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613363 |
| Molecular Formula | C16H12F5N3OS |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | benzyl N'-[[2,3-difluoro-6-(trifluoromethoxy)phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1c(OC(F)(F)F)ccc(F)c1F)SCc1ccccc1 |
| InChI | InChI=1S/C16H12F5N3OS/c17-12-6-7-13(25-16(19,20)21)11(14(12)18)8-23-24-15(22)26-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,22,24) |
| InChIKey | NRMPCSAPVZSUHU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|