C16H13BrF3N3OS — CID 168612489
benzyl N'-[[2-bromo-4-(trifluoromethoxy)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612489) has the molecular formula C16H13BrF3N3OS and a molecular weight of 432.27 g/mol. Its IUPAC name is benzyl N'-[[2-bromo-4-(trifluoromethoxy)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[2-bromo-4-(trifluoromethoxy)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612489 |
| Molecular Formula | C16H13BrF3N3OS |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | benzyl N'-[[2-bromo-4-(trifluoromethoxy)phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(OC(F)(F)F)cc1Br)SCc1ccccc1 |
| InChI | InChI=1S/C16H13BrF3N3OS/c17-14-8-13(24-16(18,19)20)7-6-12(14)9-22-23-15(21)25-10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,21,23) |
| InChIKey | KWAQPRJUGOBWPW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|