C15H12F2IN3S — CID 168612035
benzyl N'-[(2,3-difluoro-6-iodophenyl)methylideneamino]carbamimidothioate (PubChem CID 168612035) has the molecular formula C15H12F2IN3S and a molecular weight of 431.25 g/mol. Its IUPAC name is benzyl N'-[(2,3-difluoro-6-iodophenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(2,3-difluoro-6-iodophenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612035 |
| Molecular Formula | C15H12F2IN3S |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | benzyl N'-[(2,3-difluoro-6-iodophenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1c(I)ccc(F)c1F)SCc1ccccc1 |
| InChI | InChI=1S/C15H12F2IN3S/c16-12-6-7-13(18)11(14(12)17)8-20-21-15(19)22-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,19,21) |
| InChIKey | IMPNJETWZXPGII-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|