About benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate
benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate (PubChem CID 168611269) has the molecular formula C17H17F2N3OS
and a molecular weight of 349.41 g/mol. Its IUPAC name is benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate.
Molecular Properties
| Compound Name | benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate |
| PubChem CID | 168611269 |
| Molecular Formula | C17H17F2N3OS |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate |
| SMILES | CCOc1c(F)ccc(C=NN=C(N)SCc2ccccc2)c1F |
| InChI | InChI=1S/C17H17F2N3OS/c1-2-23-16-14(18)9-8-13(15(16)19)10-21-22-17(20)24-11-12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H2,20,22) |
| InChIKey | AHSPZGMYLFMRFK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate?
The IUPAC name of benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate (CID 168611269) is benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate.
What is the SMILES notation for benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate?
The canonical SMILES for benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate is CCOc1c(F)ccc(C=NN=C(N)SCc2ccccc2)c1F.
What is the InChIKey of benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate?
The InChIKey is AHSPZGMYLFMRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N3OS/c1-2-23-16-14(18)9-8-13(15(16)19)10-21-22-17(20)24-11-12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H2,20,22).
What are the key properties of benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate?
benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate has a molecular weight of 349.41 g/mol, XLogP of 3.95, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N'-[(3-ethoxy-2,4-difluorophenyl)methylideneamino]carbamimidothioate is sourced from PubChem (CID 168611269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).