C23H19N3O5S — CID 126084449
[4-[(Z)-[(4-cyanobenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] benzenesulfonate (PubChem CID 126084449) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is [4-[(Z)-[(4-cyanobenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] benzenesulfonate.
| Compound Name | [4-[(Z)-[(4-cyanobenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126084449 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [4-[(Z)-[(4-cyanobenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] benzenesulfonate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(C#N)cc2)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O5S/c1-2-30-22-14-18(16-25-26-23(27)19-11-8-17(15-24)9-12-19)10-13-21(22)31-32(28,29)20-6-4-3-5-7-20/h3-14,16H,2H2,1H3,(H,26,27)/b25-16- |
| InChIKey | GURIEUYEAOKIPF-XYGWBWBKSA-N |
| XLogP | 3.49 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|