C22H18BrN3O7S — CID 3740486
[4-[[(2-bromobenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzenesulfonate (PubChem CID 3740486) has the molecular formula C22H18BrN3O7S and a molecular weight of 548.37 g/mol. Its IUPAC name is [4-[[(2-bromobenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzenesulfonate.
| Compound Name | [4-[[(2-bromobenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3740486 |
| Molecular Formula | C22H18BrN3O7S |
| Molecular Weight | 548.37 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | [4-[[(2-bromobenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzenesulfonate |
| SMILES | CCOc1cc(C=NNC(=O)c2ccccc2Br)ccc1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18BrN3O7S/c1-2-32-21-13-15(14-24-25-22(27)18-5-3-4-6-19(18)23)7-12-20(21)33-34(30,31)17-10-8-16(9-11-17)26(28)29/h3-14H,2H2,1H3,(H,25,27) |
| InChIKey | BDZWBUQDPTXSSZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|