C21H17N3O6 — CID 4252784
[4-[[(2-methylfuran-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-methyl-4-nitrobenzoate (PubChem CID 4252784) has the molecular formula C21H17N3O6 and a molecular weight of 407.38 g/mol. Its IUPAC name is [4-[[(2-methylfuran-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-methyl-4-nitrobenzoate.
| Compound Name | [4-[[(2-methylfuran-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 4252784 |
| Molecular Formula | C21H17N3O6 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [4-[[(2-methylfuran-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)Oc2ccc(C=NNC(=O)c3ccoc3C)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O6/c1-13-11-16(5-8-19(13)24(27)28)21(26)30-17-6-3-15(4-7-17)12-22-23-20(25)18-9-10-29-14(18)2/h3-12H,1-2H3,(H,23,25) |
| InChIKey | JCUGALGDHNPJOX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|