C18H15IN4O4 — CID 3697968
[4-[[(2-methylfuran-3-carbonyl)hydrazinylidene]methyl]phenyl] 4-iodo-1-methylpyrazole-5-carboxylate (PubChem CID 3697968) has the molecular formula C18H15IN4O4 and a molecular weight of 478.25 g/mol. Its IUPAC name is [4-[[(2-methylfuran-3-carbonyl)hydrazinylidene]methyl]phenyl] 4-iodo-1-methylpyrazole-5-carboxylate.
| Compound Name | [4-[[(2-methylfuran-3-carbonyl)hydrazinylidene]methyl]phenyl] 4-iodo-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 3697968 |
| Molecular Formula | C18H15IN4O4 |
| Molecular Weight | 478.25 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | [4-[[(2-methylfuran-3-carbonyl)hydrazinylidene]methyl]phenyl] 4-iodo-1-methylpyrazole-5-carboxylate |
| SMILES | Cc1occc1C(=O)NN=Cc1ccc(OC(=O)c2c(I)cnn2C)cc1 |
| InChI | InChI=1S/C18H15IN4O4/c1-11-14(7-8-26-11)17(24)22-20-9-12-3-5-13(6-4-12)27-18(25)16-15(19)10-21-23(16)2/h3-10H,1-2H3,(H,22,24) |
| InChIKey | XJRPNCCTOHHJRB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|