C21H18N2O — CID 5405849
N-[(Z)-anthracen-9-ylmethylideneamino]-3-methylidenecyclobutane-1-carboxamide (PubChem CID 5405849) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[(Z)-anthracen-9-ylmethylideneamino]-3-methylidenecyclobutane-1-carboxamide.
| Compound Name | N-[(Z)-anthracen-9-ylmethylideneamino]-3-methylidenecyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 5405849 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[(Z)-anthracen-9-ylmethylideneamino]-3-methylidenecyclobutane-1-carboxamide |
| SMILES | C=C1CC(C(=O)N/N=C\c2c3ccccc3cc3ccccc23)C1 |
| InChI | InChI=1S/C21H18N2O/c1-14-10-17(11-14)21(24)23-22-13-20-18-8-4-2-6-15(18)12-16-7-3-5-9-19(16)20/h2-9,12-13,17H,1,10-11H2,(H,23,24)/b22-13- |
| InChIKey | ANTVAZYMZWOFSY-XKZIYDEJSA-N |
| XLogP | 4.41 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|