C28H25N3O2 — CID 126161540
(3S)-N-[(E)-anthracen-9-ylmethylideneamino]-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 126161540) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is (3S)-N-[(E)-anthracen-9-ylmethylideneamino]-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(E)-anthracen-9-ylmethylideneamino]-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126161540 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (3S)-N-[(E)-anthracen-9-ylmethylideneamino]-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1ccc(N2C[C@@H](C(=O)N/N=C/c3c4ccccc4cc4ccccc34)CC2=O)cc1 |
| InChI | InChI=1S/C28H25N3O2/c1-2-19-11-13-23(14-12-19)31-18-22(16-27(31)32)28(33)30-29-17-26-24-9-5-3-7-20(24)15-21-8-4-6-10-25(21)26/h3-15,17,22H,2,16,18H2,1H3,(H,30,33)/b29-17+/t22-/m0/s1 |
| InChIKey | QGRGMOMLMMHWFE-QHFGQAMDSA-N |
| XLogP | 5.06 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|