C22H17ClN4O5 — CID 126272778
N-[(E)-[2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 126272778) has the molecular formula C22H17ClN4O5 and a molecular weight of 452.85 g/mol. Its IUPAC name is N-[(E)-[2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126272778 |
| Molecular Formula | C22H17ClN4O5 |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-[(E)-[2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | O=C(COc1ccccc1/C=N/NC(=O)c1cccc([N+](=O)[O-])c1)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN4O5/c23-18-9-2-3-10-19(18)25-21(28)14-32-20-11-4-1-6-16(20)13-24-26-22(29)15-7-5-8-17(12-15)27(30)31/h1-13H,14H2,(H,25,28)(H,26,29)/b24-13+ |
| InChIKey | KGEADRVVXYTLSD-ZMOGYAJESA-N |
| XLogP | 4.03 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|