C35H34ClN5O7S — CID 126071219
ethyl (2Z,5R)-5-(2-chlorophenyl)-2-[[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126071219) has the molecular formula C35H34ClN5O7S and a molecular weight of 704.20 g/mol. Its IUPAC name is ethyl (2Z,5R)-5-(2-chlorophenyl)-2-[[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-5-(2-chlorophenyl)-2-[[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126071219 |
| Molecular Formula | C35H34ClN5O7S |
| Molecular Weight | 704.20 g/mol |
| Exact Mass | 703.19 |
| IUPAC Name | ethyl (2Z,5R)-5-(2-chlorophenyl)-2-[[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccc(N(CC)CC)cc3OCC(=O)Nc3cccc([N+](=O)[O-])c3)c(=O)n2[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C35H34ClN5O7S/c1-5-39(6-2)24-16-15-22(28(19-24)48-20-30(42)38-23-11-10-12-25(18-23)41(45)46)17-29-33(43)40-32(26-13-8-9-14-27(26)36)31(34(44)47-7-3)21(4)37-35(40)49-29/h8-19,32H,5-7,20H2,1-4H3,(H,38,42)/b29-17-/t32-/m0/s1 |
| InChIKey | QEBIFUKDTXEZIF-GORIGYSASA-N |
| XLogP | 5.22 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.20 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|