C19H13Cl2NO6S — CID 74019927
methyl 4-[[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dihydroxybenzoate (PubChem CID 74019927) has the molecular formula C19H13Cl2NO6S and a molecular weight of 454.29 g/mol. Its IUPAC name is methyl 4-[[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dihydroxybenzoate.
| Compound Name | methyl 4-[[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dihydroxybenzoate |
|---|---|
| PubChem CID | 74019927 |
| Molecular Formula | C19H13Cl2NO6S |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | methyl 4-[[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-dihydroxybenzoate |
| SMILES | COC(=O)c1c(O)cc(C=C2SC(=O)N(Cc3ccc(Cl)cc3Cl)C2=O)cc1O |
| InChI | InChI=1S/C19H13Cl2NO6S/c1-28-18(26)16-13(23)4-9(5-14(16)24)6-15-17(25)22(19(27)29-15)8-10-2-3-11(20)7-12(10)21/h2-7,23-24H,8H2,1H3 |
| InChIKey | SCGGYQCAQXBACO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|