C19H13Cl2NO4S — CID 124664489
methyl 4-[(E)-[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 124664489) has the molecular formula C19H13Cl2NO4S and a molecular weight of 422.29 g/mol. Its IUPAC name is methyl 4-[(E)-[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 124664489 |
| Molecular Formula | C19H13Cl2NO4S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | methyl 4-[(E)-[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2/SC(=O)N(Cc3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C19H13Cl2NO4S/c1-26-18(24)12-4-2-11(3-5-12)8-16-17(23)22(19(25)27-16)10-13-6-7-14(20)9-15(13)21/h2-9H,10H2,1H3/b16-8+ |
| InChIKey | YJBVCIOYRATJAM-LZYBPNLTSA-N |
| XLogP | 5.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|