C20H15BrClN3OS — CID 44714041
(5Z)-5-[[5-bromo-1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 44714041) has the molecular formula C20H15BrClN3OS and a molecular weight of 460.78 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 44714041 |
| Molecular Formula | C20H15BrClN3OS |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C/c2cn(Cc3ccc(Cl)cc3)c3ccc(Br)cc23)NC1=S |
| InChI | InChI=1S/C20H15BrClN3OS/c1-24-19(26)17(23-20(24)27)8-13-11-25(10-12-2-5-15(22)6-3-12)18-7-4-14(21)9-16(13)18/h2-9,11H,10H2,1H3,(H,23,27)/b17-8- |
| InChIKey | HBQDNJOLQXHQFZ-IUXPMGMMSA-N |
| XLogP | 4.79 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|