C23H19FN4O3S — CID 5198501
2-[7-ethyl-3-[[1-(4-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 5198501) has the molecular formula C23H19FN4O3S and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[7-ethyl-3-[[1-(4-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | 2-[7-ethyl-3-[[1-(4-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 5198501 |
| Molecular Formula | C23H19FN4O3S |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-[7-ethyl-3-[[1-(4-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | CCc1cccc2c(C=C3C(=O)NC(=S)N(c4ccc(F)cc4)C3=O)cn(CC(N)=O)c12 |
| InChI | InChI=1S/C23H19FN4O3S/c1-2-13-4-3-5-17-14(11-27(20(13)17)12-19(25)29)10-18-21(30)26-23(32)28(22(18)31)16-8-6-15(24)7-9-16/h3-11H,2,12H2,1H3,(H2,25,29)(H,26,30,32) |
| InChIKey | VVBFBNUUTJHQSH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|