C23H28N4O2S — CID 44714356
N-cyclohexyl-2-[7-ethyl-3-[(Z)-(1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]indol-1-yl]acetamide (PubChem CID 44714356) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is N-cyclohexyl-2-[7-ethyl-3-[(Z)-(1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]indol-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[7-ethyl-3-[(Z)-(1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 44714356 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-cyclohexyl-2-[7-ethyl-3-[(Z)-(1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]indol-1-yl]acetamide |
| SMILES | CCc1cccc2c(/C=C3\NC(=S)N(C)C3=O)cn(CC(=O)NC3CCCCC3)c12 |
| InChI | InChI=1S/C23H28N4O2S/c1-3-15-8-7-11-18-16(12-19-22(29)26(2)23(30)25-19)13-27(21(15)18)14-20(28)24-17-9-5-4-6-10-17/h7-8,11-13,17H,3-6,9-10,14H2,1-2H3,(H,24,28)(H,25,30)/b19-12- |
| InChIKey | WTSXNCPFNOPFPM-UNOMPAQXSA-N |
| XLogP | 3.34 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|