C21H21N3O2 — CID 2177673
(5E)-3-phenyl-5-[(4-piperidin-1-ylphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 2177673) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (5E)-3-phenyl-5-[(4-piperidin-1-ylphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-phenyl-5-[(4-piperidin-1-ylphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2177673 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (5E)-3-phenyl-5-[(4-piperidin-1-ylphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccc(N3CCCCC3)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H21N3O2/c25-20-19(22-21(26)24(20)18-7-3-1-4-8-18)15-16-9-11-17(12-10-16)23-13-5-2-6-14-23/h1,3-4,7-12,15H,2,5-6,13-14H2,(H,22,26)/b19-15+ |
| InChIKey | QCMHOEJBTLXZEC-XDJHFCHBSA-N |
| XLogP | 3.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|