C27H26N2O5 — CID 69395355
5-[[4-(diethoxymethyl)phenyl]methylidene]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione (PubChem CID 69395355) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 5-[[4-(diethoxymethyl)phenyl]methylidene]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-[[4-(diethoxymethyl)phenyl]methylidene]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69395355 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 5-[[4-(diethoxymethyl)phenyl]methylidene]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCOC(OCC)c1ccc(C=C2NC(=O)N(c3ccc(Oc4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-3-32-26(33-4-2)20-12-10-19(11-13-20)18-24-25(30)29(27(31)28-24)21-14-16-23(17-15-21)34-22-8-6-5-7-9-22/h5-18,26H,3-4H2,1-2H3,(H,28,31) |
| InChIKey | HWPFEJHARRYJIW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|