C20H17N2O6S- — CID 7312122
2-[2-methoxy-4-[(Z)-[1-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 7312122) has the molecular formula C20H17N2O6S- and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-[1-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-methoxy-4-[(Z)-[1-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7312122 |
| Molecular Formula | C20H17N2O6S- |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-[1-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3ccc(OCC(=O)[O-])c(OC)c3)NC2=S)cc1 |
| InChI | InChI=1S/C20H18N2O6S/c1-26-14-6-4-13(5-7-14)22-19(25)15(21-20(22)29)9-12-3-8-16(17(10-12)27-2)28-11-18(23)24/h3-10H,11H2,1-2H3,(H,21,29)(H,23,24)/p-1/b15-9- |
| InChIKey | UTZGOZCCSVFUFE-DHDCSXOGSA-M |
| XLogP | 1.09 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|