C20H17N2O5- — CID 5066560
4-[[4-[(1-ethyl-2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzoate (PubChem CID 5066560) has the molecular formula C20H17N2O5- and a molecular weight of 365.37 g/mol. Its IUPAC name is 4-[[4-[(1-ethyl-2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzoate.
| Compound Name | 4-[[4-[(1-ethyl-2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 5066560 |
| Molecular Formula | C20H17N2O5- |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-[[4-[(1-ethyl-2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzoate |
| SMILES | CCN1C(=O)NC(=Cc2ccc(OCc3ccc(C(=O)[O-])cc3)cc2)C1=O |
| InChI | InChI=1S/C20H18N2O5/c1-2-22-18(23)17(21-20(22)26)11-13-5-9-16(10-6-13)27-12-14-3-7-15(8-4-14)19(24)25/h3-11H,2,12H2,1H3,(H,21,26)(H,24,25)/p-1 |
| InChIKey | YELBVIBPDVQALK-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|