C25H21BrN2O3 — CID 126243860
(5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126243860) has the molecular formula C25H21BrN2O3 and a molecular weight of 477.36 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126243860 |
| Molecular Formula | C25H21BrN2O3 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C/c3ccc(OCc4ccc(Br)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H21BrN2O3/c1-17-2-4-19(5-3-17)15-28-24(29)23(27-25(28)30)14-18-8-12-22(13-9-18)31-16-20-6-10-21(26)11-7-20/h2-14H,15-16H2,1H3,(H,27,30)/b23-14+ |
| InChIKey | KTPKHPJNWRYJRU-OEAKJJBVSA-N |
| XLogP | 5.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|