C24H19ClN2O3 — CID 6383605
(5E)-3-[(4-chlorophenyl)methyl]-5-[(4-phenylmethoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 6383605) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is (5E)-3-[(4-chlorophenyl)methyl]-5-[(4-phenylmethoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-chlorophenyl)methyl]-5-[(4-phenylmethoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 6383605 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (5E)-3-[(4-chlorophenyl)methyl]-5-[(4-phenylmethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccc(OCc3ccccc3)cc2)C(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN2O3/c25-20-10-6-18(7-11-20)15-27-23(28)22(26-24(27)29)14-17-8-12-21(13-9-17)30-16-19-4-2-1-3-5-19/h1-14H,15-16H2,(H,26,29)/b22-14+ |
| InChIKey | KLIISPIJXODJBI-HYARGMPZSA-N |
| XLogP | 5.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|