C26H19FN4O3 — CID 5000096
2-[3-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]indol-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 5000096) has the molecular formula C26H19FN4O3 and a molecular weight of 454.46 g/mol. Its IUPAC name is 2-[3-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]indol-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[3-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]indol-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 5000096 |
| Molecular Formula | C26H19FN4O3 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-[3-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]indol-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cn1cc(C=C2C(=O)NN(c3ccccc3)C2=O)c2ccccc21)Nc1ccccc1F |
| InChI | InChI=1S/C26H19FN4O3/c27-21-11-5-6-12-22(21)28-24(32)16-30-15-17(19-10-4-7-13-23(19)30)14-20-25(33)29-31(26(20)34)18-8-2-1-3-9-18/h1-15H,16H2,(H,28,32)(H,29,33) |
| InChIKey | HRFWKFMLRCQYPB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|