C23H21N3O4 — CID 92517108
propan-2-yl 2-[3-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]indol-1-yl]acetate (PubChem CID 92517108) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is propan-2-yl 2-[3-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]indol-1-yl]acetate.
| Compound Name | propan-2-yl 2-[3-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 92517108 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | propan-2-yl 2-[3-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]indol-1-yl]acetate |
| SMILES | CC(C)OC(=O)Cn1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C23H21N3O4/c1-15(2)30-21(27)14-25-13-16(18-10-6-7-11-20(18)25)12-19-22(28)24-26(23(19)29)17-8-4-3-5-9-17/h3-13,15H,14H2,1-2H3,(H,24,28)/b19-12- |
| InChIKey | VVPPSTWLJMCWTO-UNOMPAQXSA-N |
| XLogP | 3.05 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|