C21H18ClN3O2 — CID 71835116
1-(3-chloro-4-methylphenyl)-4-[(1-ethylindol-3-yl)methylidene]pyrazolidine-3,5-dione (PubChem CID 71835116) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-4-[(1-ethylindol-3-yl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | 1-(3-chloro-4-methylphenyl)-4-[(1-ethylindol-3-yl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 71835116 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-4-[(1-ethylindol-3-yl)methylidene]pyrazolidine-3,5-dione |
| SMILES | CCn1cc(C=C2C(=O)NN(c3ccc(C)c(Cl)c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C21H18ClN3O2/c1-3-24-12-14(16-6-4-5-7-19(16)24)10-17-20(26)23-25(21(17)27)15-9-8-13(2)18(22)11-15/h4-12H,3H2,1-2H3,(H,23,26) |
| InChIKey | ISEIGOJQNXIJGF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|