C25H18ClN3O2 — CID 1190981
4-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 1190981) has the molecular formula C25H18ClN3O2 and a molecular weight of 427.89 g/mol. Its IUPAC name is 4-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | 4-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 1190981 |
| Molecular Formula | C25H18ClN3O2 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)C1=Cc1cn(Cc2ccccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C25H18ClN3O2/c26-22-12-6-4-8-17(22)15-28-16-18(20-11-5-7-13-23(20)28)14-21-24(30)27-29(25(21)31)19-9-2-1-3-10-19/h1-14,16H,15H2,(H,27,30) |
| InChIKey | SOTAPEXVWFGDQZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|