C28H26ClN3O3 — CID 163325901
(4Z)-4-[[1-(2-methyl-3-phenoxypropyl)indol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione;hydrochloride (PubChem CID 163325901) has the molecular formula C28H26ClN3O3 and a molecular weight of 487.99 g/mol. Its IUPAC name is (4Z)-4-[[1-(2-methyl-3-phenoxypropyl)indol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione;hydrochloride.
| Compound Name | (4Z)-4-[[1-(2-methyl-3-phenoxypropyl)indol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione;hydrochloride |
|---|---|
| PubChem CID | 163325901 |
| Molecular Formula | C28H26ClN3O3 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (4Z)-4-[[1-(2-methyl-3-phenoxypropyl)indol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione;hydrochloride |
| SMILES | CC(COc1ccccc1)Cn1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)c2ccccc21.Cl |
| InChI | InChI=1S/C28H25N3O3.ClH/c1-20(19-34-23-12-6-3-7-13-23)17-30-18-21(24-14-8-9-15-26(24)30)16-25-27(32)29-31(28(25)33)22-10-4-2-5-11-22;/h2-16,18,20H,17,19H2,1H3,(H,29,32);1H/b25-16-; |
| InChIKey | FLKVEZJAQZGZOA-KJEABERCSA-N |
| XLogP | 5.24 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|