C27H27N3O5 — CID 5129480
propan-2-yl 2-[4-[3-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]acetate (PubChem CID 5129480) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is propan-2-yl 2-[4-[3-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[3-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 5129480 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | propan-2-yl 2-[4-[3-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]acetate |
| SMILES | Cc1cc(C=C2C(=O)NN(c3ccccc3)C2=O)c(C)n1-c1ccc(OCC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C27H27N3O5/c1-17(2)35-25(31)16-34-23-12-10-21(11-13-23)29-18(3)14-20(19(29)4)15-24-26(32)28-30(27(24)33)22-8-6-5-7-9-22/h5-15,17H,16H2,1-4H3,(H,28,32) |
| InChIKey | UIGROZHKDKMZGP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|