C27H19FN4O4 — CID 1366595
2-[3-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-phenylacetamide (PubChem CID 1366595) has the molecular formula C27H19FN4O4 and a molecular weight of 482.47 g/mol. Its IUPAC name is 2-[3-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[3-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 1366595 |
| Molecular Formula | C27H19FN4O4 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[3-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1cc(C=C2C(=O)NC(=O)N(c3ccccc3F)C2=O)c2ccccc21)Nc1ccccc1 |
| InChI | InChI=1S/C27H19FN4O4/c28-21-11-5-7-13-23(21)32-26(35)20(25(34)30-27(32)36)14-17-15-31(22-12-6-4-10-19(17)22)16-24(33)29-18-8-2-1-3-9-18/h1-15H,16H2,(H,29,33)(H,30,34,36) |
| InChIKey | GOFVJJKQFLBKSM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|