C28H19ClN4O5S — CID 4593790
3-[5-[[1-[2-(4-chloroanilino)-2-oxoethyl]indol-3-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 4593790) has the molecular formula C28H19ClN4O5S and a molecular weight of 559.00 g/mol. Its IUPAC name is 3-[5-[[1-[2-(4-chloroanilino)-2-oxoethyl]indol-3-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[1-[2-(4-chloroanilino)-2-oxoethyl]indol-3-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4593790 |
| Molecular Formula | C28H19ClN4O5S |
| Molecular Weight | 559.00 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 3-[5-[[1-[2-(4-chloroanilino)-2-oxoethyl]indol-3-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | O=C(Cn1cc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)c2ccccc21)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H19ClN4O5S/c29-18-8-10-19(11-9-18)30-24(34)15-32-14-17(21-6-1-2-7-23(21)32)13-22-25(35)31-28(39)33(26(22)36)20-5-3-4-16(12-20)27(37)38/h1-14H,15H2,(H,30,34)(H,37,38)(H,31,35,39) |
| InChIKey | WAYXQKOYYFBEFB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.00 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|