C29H21F3N4O3S — CID 126255393
2-[3-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 126255393) has the molecular formula C29H21F3N4O3S and a molecular weight of 562.57 g/mol. Its IUPAC name is 2-[3-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[3-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126255393 |
| Molecular Formula | C29H21F3N4O3S |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 2-[3-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2cc(/C=C3\C(=O)NC(=S)N(c4cccc(C(F)(F)F)c4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H21F3N4O3S/c1-17-9-11-20(12-10-17)33-25(37)16-35-15-18(22-7-2-3-8-24(22)35)13-23-26(38)34-28(40)36(27(23)39)21-6-4-5-19(14-21)29(30,31)32/h2-15H,16H2,1H3,(H,33,37)(H,34,38,40)/b23-13+ |
| InChIKey | MVPDLWRJVJUXKK-YDZHTSKRSA-N |
| XLogP | 5.44 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|