C29H23FN4O5S — CID 126077205
2-[3-[(E)-[1-(2,4-dimethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 126077205) has the molecular formula C29H23FN4O5S and a molecular weight of 558.59 g/mol. Its IUPAC name is 2-[3-[(E)-[1-(2,4-dimethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-[(E)-[1-(2,4-dimethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126077205 |
| Molecular Formula | C29H23FN4O5S |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 2-[3-[(E)-[1-(2,4-dimethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3cn(CC(=O)Nc4ccc(F)cc4)c4ccccc34)C(=O)NC2=S)c(OC)c1 |
| InChI | InChI=1S/C29H23FN4O5S/c1-38-20-11-12-24(25(14-20)39-2)34-28(37)22(27(36)32-29(34)40)13-17-15-33(23-6-4-3-5-21(17)23)16-26(35)31-19-9-7-18(30)8-10-19/h3-15H,16H2,1-2H3,(H,31,35)(H,32,36,40)/b22-13+ |
| InChIKey | HADVUHZADVMEMV-LPYMAVHISA-N |
| XLogP | 4.27 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|