C22H19N3O4S — CID 4014913
1-(2,5-dimethoxyphenyl)-5-[(1-methylindol-3-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 4014913) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-[(1-methylindol-3-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-[(1-methylindol-3-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 4014913 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-[(1-methylindol-3-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(OC)c(N2C(=O)C(=Cc3cn(C)c4ccccc34)C(=O)NC2=S)c1 |
| InChI | InChI=1S/C22H19N3O4S/c1-24-12-13(15-6-4-5-7-17(15)24)10-16-20(26)23-22(30)25(21(16)27)18-11-14(28-2)8-9-19(18)29-3/h4-12H,1-3H3,(H,23,26,30) |
| InChIKey | RHKDKCGRYAMNQL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|