C21H21BrN4O3 — CID 2921591
2-[4-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 2921591) has the molecular formula C21H21BrN4O3 and a molecular weight of 457.33 g/mol. Its IUPAC name is 2-[4-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2921591 |
| Molecular Formula | C21H21BrN4O3 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 2-[4-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)NC(=Cc3ccc(N(C)C)c(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H21BrN4O3/c1-13-4-7-15(8-5-13)23-19(27)12-26-20(28)17(24-21(26)29)11-14-6-9-18(25(2)3)16(22)10-14/h4-11H,12H2,1-3H3,(H,23,27)(H,24,29) |
| InChIKey | WSOHBUZJWMQPOZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|