C27H21Br2N3O6 — CID 126029364
4-[[2,6-dibromo-4-[(E)-[1-[2-(4-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126029364) has the molecular formula C27H21Br2N3O6 and a molecular weight of 643.29 g/mol. Its IUPAC name is 4-[[2,6-dibromo-4-[(E)-[1-[2-(4-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dibromo-4-[(E)-[1-[2-(4-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126029364 |
| Molecular Formula | C27H21Br2N3O6 |
| Molecular Weight | 643.29 g/mol |
| Exact Mass | 640.98 |
| IUPAC Name | 4-[[2,6-dibromo-4-[(E)-[1-[2-(4-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)N/C(=C/c3cc(Br)c(OCc4ccc(C(=O)O)cc4)c(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H21Br2N3O6/c1-15-2-8-19(9-3-15)30-23(33)13-32-25(34)22(31-27(32)37)12-17-10-20(28)24(21(29)11-17)38-14-16-4-6-18(7-5-16)26(35)36/h2-12H,13-14H2,1H3,(H,30,33)(H,31,37)(H,35,36)/b22-12+ |
| InChIKey | SQOZQEAJGQNEFP-WSDLNYQXSA-N |
| XLogP | 5.33 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|