C24H19N3O9 — CID 3930008
5-[[2-methoxy-4-[[1-[(4-nitrophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 3930008) has the molecular formula C24H19N3O9 and a molecular weight of 493.43 g/mol. Its IUPAC name is 5-[[2-methoxy-4-[[1-[(4-nitrophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-methoxy-4-[[1-[(4-nitrophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 3930008 |
| Molecular Formula | C24H19N3O9 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 5-[[2-methoxy-4-[[1-[(4-nitrophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(C=C2NC(=O)N(Cc3ccc([N+](=O)[O-])cc3)C2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C24H19N3O9/c1-34-21-11-15(4-8-19(21)35-13-17-7-9-20(36-17)23(29)30)10-18-22(28)26(24(31)25-18)12-14-2-5-16(6-3-14)27(32)33/h2-11H,12-13H2,1H3,(H,25,31)(H,29,30) |
| InChIKey | OUPASDWBBNPUEI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 161.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|