C24H19ClN2O7 — CID 3589666
5-[[4-[[1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 3589666) has the molecular formula C24H19ClN2O7 and a molecular weight of 482.88 g/mol. Its IUPAC name is 5-[[4-[[1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[[1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 3589666 |
| Molecular Formula | C24H19ClN2O7 |
| Molecular Weight | 482.88 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 5-[[4-[[1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(C=C2NC(=O)N(Cc3ccccc3Cl)C2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C24H19ClN2O7/c1-32-21-11-14(6-8-19(21)33-13-16-7-9-20(34-16)23(29)30)10-18-22(28)27(24(31)26-18)12-15-4-2-3-5-17(15)25/h2-11H,12-13H2,1H3,(H,26,31)(H,29,30) |
| InChIKey | JVQFVEAZROQQPT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.88 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|