C26H28N4O8 — CID 126019746
(2R)-2-[2-methoxy-4-[(Z)-[1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 126019746) has the molecular formula C26H28N4O8 and a molecular weight of 524.53 g/mol. Its IUPAC name is (2R)-2-[2-methoxy-4-[(Z)-[1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-methoxy-4-[(Z)-[1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126019746 |
| Molecular Formula | C26H28N4O8 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (2R)-2-[2-methoxy-4-[(Z)-[1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | COc1cc(/C=C2\NC(=O)N(CC(=O)Nc3ccc(N4CCOCC4)cc3)C2=O)ccc1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C26H28N4O8/c1-16(25(33)34)38-21-8-3-17(14-22(21)36-2)13-20-24(32)30(26(35)28-20)15-23(31)27-18-4-6-19(7-5-18)29-9-11-37-12-10-29/h3-8,13-14,16H,9-12,15H2,1-2H3,(H,27,31)(H,28,35)(H,33,34)/b20-13-/t16-/m1/s1 |
| InChIKey | LQQVJHZNTWUGTM-FPXKJXHESA-N |
| XLogP | 1.92 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|