C22H19ClN3O7- — CID 2175604
(2R)-2-[4-[(Z)-[1-[2-(4-chloroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]propanoate (PubChem CID 2175604) has the molecular formula C22H19ClN3O7- and a molecular weight of 472.86 g/mol. Its IUPAC name is (2R)-2-[4-[(Z)-[1-[2-(4-chloroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]propanoate.
| Compound Name | (2R)-2-[4-[(Z)-[1-[2-(4-chloroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 2175604 |
| Molecular Formula | C22H19ClN3O7- |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | (2R)-2-[4-[(Z)-[1-[2-(4-chloroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]propanoate |
| SMILES | COc1cc(/C=C2\NC(=O)N(CC(=O)Nc3ccc(Cl)cc3)C2=O)ccc1O[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C22H20ClN3O7/c1-12(21(29)30)33-17-8-3-13(10-18(17)32-2)9-16-20(28)26(22(31)25-16)11-19(27)24-15-6-4-14(23)5-7-15/h3-10,12H,11H2,1-2H3,(H,24,27)(H,25,31)(H,29,30)/p-1/b16-9-/t12-/m1/s1 |
| InChIKey | DDTNAMOAFRUEJE-DZZSIBQASA-M |
| XLogP | 1.40 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|