C24H19ClN2O6S — CID 135538504
methyl 5-[[4-[[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 135538504) has the molecular formula C24H19ClN2O6S and a molecular weight of 498.94 g/mol. Its IUPAC name is methyl 5-[[4-[[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 135538504 |
| Molecular Formula | C24H19ClN2O6S |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | methyl 5-[[4-[[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(C=C3S/C(=N/c4ccc(Cl)cc4)NC3=O)cc2OC)o1 |
| InChI | InChI=1S/C24H19ClN2O6S/c1-30-20-11-14(3-9-18(20)32-13-17-8-10-19(33-17)23(29)31-2)12-21-22(28)27-24(34-21)26-16-6-4-15(25)5-7-16/h3-12H,13H2,1-2H3,(H,26,27,28) |
| InChIKey | QFCCFVHKHMQVIL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|