C24H19ClN2O6S — CID 137137639
5-[[4-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 137137639) has the molecular formula C24H19ClN2O6S and a molecular weight of 498.94 g/mol. Its IUPAC name is 5-[[4-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 137137639 |
| Molecular Formula | C24H19ClN2O6S |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 5-[[4-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=C2\S/C(=N/c3cccc(Cl)c3C)NC2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C24H19ClN2O6S/c1-13-16(25)4-3-5-17(13)26-24-27-22(28)21(34-24)11-14-6-8-18(20(10-14)31-2)32-12-15-7-9-19(33-15)23(29)30/h3-11H,12H2,1-2H3,(H,29,30)(H,26,27,28)/b21-11- |
| InChIKey | JWZJUZHVQPWDHQ-NHDPSOOVSA-N |
| XLogP | 5.42 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|