C29H23ClN2O3S — CID 137136507
(5E)-2-(3-chloro-2-methylphenyl)imino-5-[[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137136507) has the molecular formula C29H23ClN2O3S and a molecular weight of 515.03 g/mol. Its IUPAC name is (5E)-2-(3-chloro-2-methylphenyl)imino-5-[[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137136507 |
| Molecular Formula | C29H23ClN2O3S |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2/S/C(=N\c3cccc(Cl)c3C)NC2=O)ccc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H23ClN2O3S/c1-18-23(30)8-5-9-24(18)31-29-32-28(33)27(36-29)16-19-11-13-25(26(15-19)34-2)35-17-20-10-12-21-6-3-4-7-22(21)14-20/h3-16H,17H2,1-2H3,(H,31,32,33)/b27-16+ |
| InChIKey | GCCGMKIMBMVLSJ-JVWAILMASA-N |
| XLogP | 7.28 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|