C19H15Br2NO4S — CID 126171192
(5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-[(3-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126171192) has the molecular formula C19H15Br2NO4S and a molecular weight of 513.21 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-[(3-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-[(3-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126171192 |
| Molecular Formula | C19H15Br2NO4S |
| Molecular Weight | 513.21 g/mol |
| Exact Mass | 510.91 |
| IUPAC Name | (5Z)-5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-[(3-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(Cc3cccc(Br)c3)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C19H15Br2NO4S/c1-2-26-16-7-12(14(21)9-15(16)23)8-17-18(24)22(19(25)27-17)10-11-4-3-5-13(20)6-11/h3-9,23H,2,10H2,1H3/b17-8- |
| InChIKey | PNISFMSDJMUDDA-IUXPMGMMSA-N |
| XLogP | 5.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.21 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|